Sea regions
Atlantic Ocean(723183)North Atlantic Ocean(618448)Northeast Atlantic Ocean (40W)(551105)Mediterranean Region(359236)Mediterranean Sea(316081)Mediterranean Sea, Eastern Basin(187739)More
Discipline (P08)
Administration and dimensions(1533394)Physical oceanography(1330107)Chemical oceanography(617633)Biological oceanography(306731)Marine geology(102719)Terrestrial(56382)Human activities(51331)Environment(51308)Atmosphere(11914)Cross-discipline(6413)Fisheries and aquaculture(309)
Parameter Group (P03)
Administration and dimensions(1533394)Water column temperature and salinity(1294831)Dissolved gases(431970)Carbon, nitrogen and phosphorus(326438)Nutrients(308253)Pigments(282264)More
Discovery Parameter (P02)
Temperature of the water column(1271180)Salinity of the water column(1022569)Dissolved oxygen parameters in the water column(431868)Phosphate concentration parameters in the water column(279976)Chlorophyll pigment concentrations in water bodies(235802)Silicate concentration parameters in the water column(234147)More
Measuring area type
Instrument Type
CTD(617476)water temperature sensor(478208)salinity sensor(474442)discrete water samplers(423204)Expendable bathythermographs(180172)water pressure sensors(168994)More
Platform type
research vessel(488832)drifting subsurface profiling float(414127)unknown(312396)ship(130648)naval vessel(46184)lowered unmanned submersible(38410)More
Cruise Summary Report (CSR)
PRIMA - Thetis(48TH)(27739)CIRENE 2007 - Le Suroit(35LU)(1101)SESAME-IT2: Ionian Sea - Urania(48UR)(916)SAREVA 0408 - Cornide de Saavedra(29CS)(843)SESAME-IT1: Adriatic Sea - Urania(48UR)(801)SESAME-IT7: Adriatic Sea - Urania(48UR)(663)More
Point of contact
(SISMER) Ifremer, Scientific Information Systems for the sea(584270)(SHOM) Hydrographic and oceanographic service of the French navy(193434)(ICES) International Council for the Exploration of the Sea (98939)(BODC) British Oceanographic Data Centre(92367)(RIHMI-WDC) All-Russia Research Institute of Hydrometeorological Information, World Data Centre, National Oceanographic Data Centre (NODC)(87638)(OGS) National Institute of Oceanography and Applied Geophysics - OGS, Division of Oceanography(77155)More
Point of contact country
France(781637)Denmark(161139)Russian Federation(121685)United Kingdom(92368)Italy(90850)Spain(61805)More
Data originator
(SHOM) Hydrographic and oceanographic service of the French navy(259985)(OGS) National Institute of Oceanography and Applied Geophysics - OGS, Division of Oceanography(98267)(Ifremer) Ifremer Head Office(75012)(BSH) Federal Maritime and Hydrographic Agency(66536)(IEO-CSIC) IEO-CSIC, Spanish Oceanographic Institute(65616)Aarhus University, Department of Bioscience, Marine Ecology Roskilde(62200)More
Data originator country
France(500120)United Kingdom(198486)Italy(133093)Russian Federation(114725)Germany(99532)Denmark(86762)More
Data Access restriction
Ices areas
Greater North Sea(111572)Western Mediterranean Sea(98562)Bay of Biscay and the Iberian Coast(95147)Baltic Sea(92997)Celtic Seas(73249)Adriatic Sea(60054)Oceanic Northeast Atlantic(51806)Aegean-Levantine Sea(36195)Norwegian Sea(31496)Ionian Sea and the Central Mediterranean Sea(23436)Black Sea(23086)Barents Sea(22445)Icelandic waters(8848)Greenland Sea(8722)Faroes(3974)Azores(3452)Arctic Ocean(227)
Helcom areas
Great Belt(27544)Kattegat(15387)Northern Baltic Proper(10702)Eastern Gotland Basin(10115)Bornholm Basin(8330)Gulf of Finland(7041)Arkona Basin(5360)Western Gotland Basin(5121)Bothnian Sea(5061)Gulf of Riga(2324)Bothnian Bay(2243)Kiel Bay(2047)Gdansk Basin(1819)Åland Sea(1600)The Sound(1315)Bay of Mecklenburg(1287)The Quark(874)
Ospar areas
Greater North Sea(123880)Bay of Biscay and Iberian Coast(92890)Wider Atlantic(78029)Arctic Waters(74487)Celtic Seas(39356)
MSFD areas
North East Atlantic Ocean(436295)Mediterranean Sea(316091)Greater North Sea(162606)Baltic Sea(119972)Black Sea(43166)
| Dataset name | Country originator | Start date | Instrument / gear type | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| A011185h.baz | Russian Federation | 19770407 | discrete water samplers | ||||||||
 | |||||||||||
| A011185h.baz | Russian Federation | 19770407 | discrete water samplers | ||||||||
| |||||||||||
| RNODC_Bottle_8310 | Ukraine | 19710807 | discrete water samplers | ||||||||
| |||||||||||
| Measurements at Noordwijk 20 km uit de kust in 1989 by RIKZMON_CHEMIE using POMP | Netherlands | 19890221 | unknown | ||||||||
| |||||||||||
| OGS - Single-beam (1965) | Italy | 19650101 | single-beam echosounders | ||||||||
| |||||||||||
| OGS - Single-beam (1966) | Italy | 19660101 | single-beam echosounders | ||||||||
| |||||||||||
| OGS - Single-beam (1967) | Italy | 19670101 | single-beam echosounders | ||||||||
| |||||||||||
| OGS - Single-beam (1968) | Italy | 19680101 | single-beam echosounders | ||||||||
| |||||||||||
| OGS - Single-beam (1972) | Italy | 19720101 | single-beam echosounders | ||||||||
| |||||||||||
| The Golden Horn_10 | Turkey | 20040227 | CTD | ||||||||
| |||||||||||
| D01_SI29199510024.dat | Spain | 19951024 | current meters | ||||||||
| |||||||||||
| D01_SI29199510024.dat | Spain | 19951024 | current meters | ||||||||
| |||||||||||
| D01_SI29199510024.dat | Spain | 19951024 | current meters | ||||||||
| |||||||||||
| D01_SI29199510024.dat | Spain | 19951024 | current meters | ||||||||
| |||||||||||
| D01_SI29199510024.dat | Spain | 19951024 | current meters | ||||||||
| |||||||||||
| D01_SI29199602023.dat | Spain | 19960223 | current meters | ||||||||
| |||||||||||
| D01_SI29199602023.dat | Spain | 19960223 | current meters | ||||||||
| |||||||||||
| D01_SI29199602023.dat | Spain | 19960223 | current meters | ||||||||
| |||||||||||
| D01_SI29199602023.dat | Spain | 19960223 | current meters | ||||||||
| |||||||||||
| D01_SI29199602023.dat | Spain | 19960223 | current meters | ||||||||
| |||||||||||
| D01_SI29199607007.dat | Spain | 19960706 | current meters | ||||||||
| |||||||||||
| D01_SI29199607007.dat | Spain | 19960706 | current meters | ||||||||
| |||||||||||
| D01_SI29199607007.dat | Spain | 19960706 | current meters | ||||||||
| |||||||||||
| D01_SI29199607007.dat | Spain | 19960706 | current meters | ||||||||
| |||||||||||
| D01_SI29199607007.dat | Spain | 19960706 | current meters | ||||||||
| |||||||||||
| D01_SI29199612007.dat | Spain | 19961207 | current meters | ||||||||
| |||||||||||
| D01_SI29199612007.dat | Spain | 19961207 | current meters | ||||||||
| |||||||||||
| D01_SI29199612007.dat | Spain | 19961207 | current meters | ||||||||
| |||||||||||
| D01_SI29199612007.dat | Spain | 19961207 | current meters | ||||||||
| |||||||||||
| D01_SI29199612007.dat | Spain | 19961207 | current meters | ||||||||
| |||||||||||
| A011185h.baz | Russian Federation | 19770407 | discrete water samplers | ||||||||
| |||||||||||
| D01_SI29199702018.dat | Spain | 19970217 | current meters | ||||||||
| |||||||||||
| D01_SI29199702018.dat | Spain | 19970217 | current meters | ||||||||
| |||||||||||
| D01_SI29199702018.dat | Spain | 19970217 | current meters | ||||||||
| |||||||||||
| D01_SI29199702018.dat | Spain | 19970217 | current meters | ||||||||
| |||||||||||
| D01_SI29199702018.dat | Spain | 19970217 | current meters | ||||||||
| |||||||||||
| D01_SI29199703015.dat | Spain | 19970315 | current meters | ||||||||
| |||||||||||
| D01_SI29199703015.dat | Spain | 19970315 | current meters | ||||||||
| |||||||||||
| D01_SI29199703015.dat | Spain | 19970315 | current meters | ||||||||
| |||||||||||
| D01_SI29199703015.dat | Spain | 19970315 | current meters | ||||||||
| |||||||||||
| D01_SI29199703015.dat | Spain | 19970315 | current meters | ||||||||
| |||||||||||
| D01_SI29199705001.dat | Spain | 19970501 | current meters | ||||||||
| |||||||||||
| D01_SI29199705001.dat | Spain | 19970501 | current meters | ||||||||
| |||||||||||
| D01_SI29199705001.dat | Spain | 19970501 | current meters | ||||||||
| |||||||||||
| D01_SI29199707017.dat | Spain | 19970717 | current meters | ||||||||
| |||||||||||
| D01_SI29199707017.dat | Spain | 19970717 | current meters | ||||||||
| |||||||||||
| D01_SI29199707017.dat | Spain | 19970717 | current meters | ||||||||
| |||||||||||
| D01_SI29199707017.dat | Spain | 19970717 | current meters | ||||||||
| |||||||||||
| D01_SI29199707017.dat | Spain | 19970717 | current meters | ||||||||
| |||||||||||
| D01_SI29199707017.dat | Spain | 19970717 | current meters | ||||||||
| |||||||||||
| D01_SI29199707116.dat | Spain | 19970716 | current meters | ||||||||
| |||||||||||
| D01_SI29199707116.dat | Spain | 19970716 | current meters | ||||||||
| |||||||||||
| D01_SI29199707116.dat | Spain | 19970716 | current meters | ||||||||
| |||||||||||
| D01_SI29199707116.dat | Spain | 19970716 | current meters | ||||||||
| |||||||||||
| D01_SI29199707116.dat | Spain | 19970715 | current meters | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00010) | Spain | 19970911 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00020) | Spain | 19970911 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00030) | Spain | 19970911 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00040) | Spain | 19970911 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00050) | Spain | 19970912 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00060) | Spain | 19970912 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00070) | Spain | 19970912 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00080) | Spain | 19970912 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00090) | Spain | 19970912 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00100) | Spain | 19970912 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00110) | Spain | 19970912 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00120) | Spain | 19970912 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00130) | Spain | 19970912 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00140) | Spain | 19970913 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00150) | Spain | 19970913 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00160) | Spain | 19970913 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00170) | Spain | 19970913 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00180) | Spain | 19970913 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00190) | Spain | 19970913 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00200) | Spain | 19970913 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00210) | Spain | 19970913 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00220) | Spain | 19970914 | discrete water samplers | ||||||||
| |||||||||||
| CANIGO-leg2 1997-09(00230) | Spain | 19970914 | discrete water samplers | ||||||||
| |||||||||||
| D01_SI29199710025.dat | Spain | 19971025 | current meters | ||||||||
| |||||||||||
| D01_SI29199710025.dat | Spain | 19971025 | current meters | ||||||||
| |||||||||||
| D01_SI29199710025.dat | Spain | 19971025 | current meters | ||||||||
| |||||||||||
| D01_SI29199710025.dat | Spain | 19971025 | current meters | ||||||||
| |||||||||||
| D01_SI29199710025.dat | Spain | 19971025 | current meters | ||||||||
| |||||||||||
| D01_SI29199802019.dat | Spain | 19980218 | current meters | ||||||||
| |||||||||||
| D01_SI29199802019.dat | Spain | 19980218 | current meters | ||||||||
| |||||||||||
| D01_SI29199802019.dat | Spain | 19980218 | current meters | ||||||||
| |||||||||||
| D01_SI29199802019.dat | Spain | 19980218 | current meters | ||||||||
| |||||||||||
| D01_SI29199802019.dat | Spain | 19980218 | current meters | ||||||||
| |||||||||||
| D01_SI29199802019.dat | Spain | 19980218 | current meters | ||||||||
| |||||||||||
| D01_SI29199803026.dat | Spain | 19980325 | current meters | ||||||||
| |||||||||||
| D01_SI29199803026.dat | Spain | 19980325 | current meters | ||||||||
| |||||||||||
| D01_SI29199803026.dat | Spain | 19980325 | current meters | ||||||||
| |||||||||||
| D01_SI29199803026.dat | Spain | 19980325 | current meters | ||||||||
| |||||||||||
| D01_SI29199803026.dat | Spain | 19980325 | current meters | ||||||||
| |||||||||||
| 77SO1989_02037_H09 | Sweden | 19890615 | discrete water samplers | ||||||||
| |||||||||||
| 77SO1990_02081_H09 | Sweden | 19901017 | discrete water samplers | ||||||||
| |||||||||||
| 77SO1999_02060_H09 | Sweden | 19990808 | discrete water samplers | ||||||||
| |||||||||||
| 77SO2007_02016_H09 | Sweden | 20070226 | discrete water samplers | ||||||||
| |||||||||||
| 77SO2007_02081_H09 | Sweden | 20071205 | discrete water samplers | ||||||||
| |||||||||||
| 77SO2007_02085_H09 | Sweden | 20071205 | discrete water samplers | ||||||||
| |||||||||||