Sea regions
Atlantic Ocean(431605)North Atlantic Ocean(379020)Northeast Atlantic Ocean (40W)(340500)Baltic Sea(228792)Mediterranean Region(212275)Mediterranean Sea(170937)More
Discipline (P08)
Physical oceanography(1032199)Administration and dimensions(618269)Chemical oceanography(403019)Biological oceanography(149648)Marine geology(47060)Terrestrial(18384)Cross-discipline(7664)Human activities(2572)Environment(2469)Atmosphere(2446)Fisheries and aquaculture(103)
Parameter Group (P03)
Water column temperature and salinity(1031319)Administration and dimensions(618269)Dissolved gases(379487)Pigments(149505)Optical properties(106015)Other physical oceanographic measurements(102212)More
Discovery Parameter (P02)
Temperature of the water column(1014001)Salinity of the water column(987570)Vertical spatial coordinates(617476)Dissolved oxygen parameters in the water column(379388)Electrical conductivity of the water column(118044)Chlorophyll pigment concentrations in water bodies(109305)More
Measuring area type
Platform type
research vessel(501785)drifting subsurface profiling float(241196)unknown(114346)ship(109679)lowered unmanned submersible(20000)mooring(19175)More
Cruise Summary Report (CSR)
64pe497 - Pelagia(64PE)(3135)CIRENE 2007 - Le Suroit(35LU)(1101)SAREVA 0408 - Cornide de Saavedra(29CS)(843)SEMAPHORE - Le Suroit(35LU)(635)PRISMA 2/2 - Coopernaut Franca(48CF)(433)SAREVA 0317 - Vizconde de Eza(29VE)(433)More
Point of contact
(SISMER) Ifremer, Scientific Information Systems for the sea(292646)Aarhus University, Department of Bioscience, Marine Ecology Roskilde(148630)(NMD) Institute of Marine Research, Norwegian Marine Data Centre(85247)(ICES) International Council for the Exploration of the Sea (84248)(BODC) British Oceanographic Data Centre(64400)(OGS) National Institute of Oceanography and Applied Geophysics - OGS, Division of Oceanography(56676)More
Point of contact country
Data originator
Aarhus University, Department of Bioscience, Marine Ecology Roskilde(148630)(IMR) Institute of Marine Research(98927)(BODC) British Oceanographic Data Centre(53603)(BSH) Federal Maritime and Hydrographic Agency(49710)(OGS) National Institute of Oceanography and Applied Geophysics - OGS, Division of Oceanography(46877)(IEO-CSIC) IEO-CSIC, Spanish Oceanographic Institute(46613)More
Data originator country
Data Access restriction
Ices areas
Western Mediterranean Sea(54159)Baltic Sea(50152)Celtic Seas(47524)Greater North Sea(40352)Bay of Biscay and the Iberian Coast(34377)Oceanic Northeast Atlantic(27865)Aegean-Levantine Sea(25916)Adriatic Sea(25385)Norwegian Sea(15535)Black Sea(13476)Ionian Sea and the Central Mediterranean Sea(10577)Barents Sea(6990)Icelandic waters(6772)Greenland Sea(5592)Faroes(3356)Azores(1987)Arctic Ocean(144)
Helcom areas
Bornholm Basin(9411)Eastern Gotland Basin(8990)Great Belt(7775)Gdansk Basin(5079)Kattegat(4104)Gulf of Finland(4022)Arkona Basin(3544)Kiel Bay(2119)Bothnian Sea(2034)Northern Baltic Proper(1953)Bay of Mecklenburg(1636)Gulf of Riga(1078)Western Gotland Basin(849)Bothnian Bay(756)Åland Sea(448)The Sound(253)The Quark(155)
Ospar areas
Greater North Sea(49401)Wider Atlantic(48618)Arctic Waters(36909)Bay of Biscay and Iberian Coast(33556)Celtic Seas(21266)
MSFD areas
North East Atlantic Ocean(265661)Greater North Sea(192008)Baltic Sea(183054)Mediterranean Sea(170970)Black Sea(41338)
| Dataset name | Country originator | Start date | Instrument / gear type | ||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| 08V1_LT1B_CTD | Lithuania | 20080212 | CTD | ||||||||
 | |||||||||||
| 08V1_LT1_CTD | Lithuania | 20080211 | CTD | ||||||||
| |||||||||||
| 08V1_LT2C_CTD | Lithuania | 20080212 | CTD | ||||||||
| |||||||||||
| 08V1_LT2_CTD | Lithuania | 20080211 | CTD | ||||||||
| |||||||||||
| 08V1_LT3_CTD | Lithuania | 20080211 | CTD | ||||||||
| |||||||||||
| 08V1_LT46_CTD | Lithuania | 20080212 | CTD | ||||||||
| |||||||||||
| 08V1_LT4C_CTD | Lithuania | 20080212 | CTD | ||||||||
| |||||||||||
| 08V1_LT4_CTD | Lithuania | 20080212 | CTD | ||||||||
| |||||||||||
| 08V1_LT5_CTD | Lithuania | 20080213 | CTD | ||||||||
| |||||||||||
| 08V1_LT64A_CTD | Lithuania | 20080212 | CTD | ||||||||
| |||||||||||
| 08V1_LT64_CTD | Lithuania | 20080212 | CTD | ||||||||
| |||||||||||
| 08V1_LT65_CTD | Lithuania | 20080212 | CTD | ||||||||
| |||||||||||
| 08V1_LT66_CTD | Lithuania | 20080212 | CTD | ||||||||
| |||||||||||
| 08V1_LT6B_CTD | Lithuania | 20080213 | CTD | ||||||||
| |||||||||||
| 08V1_LT6_CTD | Lithuania | 20080213 | CTD | ||||||||
| |||||||||||
| 08V1_LT7_CTD | Lithuania | 20080213 | CTD | ||||||||
| |||||||||||
| 08V1_LTB-1_CTD | Lithuania | 20080211 | CTD | ||||||||
| |||||||||||
| 08V1_LTB-4_CTD | Lithuania | 20080212 | CTD | ||||||||
| |||||||||||
| 08V1_LTN-6_CTD | Lithuania | 20080213 | CTD | ||||||||
| |||||||||||
| 08V2_LT1_CTD | Lithuania | 20080507 | CTD | ||||||||
| |||||||||||
| 08V2_LT2_CTD | Lithuania | 20080507 | CTD | ||||||||
| |||||||||||
| 08V2_LT3_CTD | Lithuania | 20080507 | CTD | ||||||||
| |||||||||||
| 08V2_LT4C_CTD | Lithuania | 20080508 | CTD | ||||||||
| |||||||||||
| 08V2_LT4_CTD | Lithuania | 20080508 | CTD | ||||||||
| |||||||||||
| 08V2_LT5_CTD | Lithuania | 20080508 | CTD | ||||||||
| |||||||||||
| 08V2_LT64A_CTD | Lithuania | 20080508 | CTD | ||||||||
| |||||||||||
| 08V2_LT64_CTD | Lithuania | 20080508 | CTD | ||||||||
| |||||||||||
| 08V2_LT65_CTD | Lithuania | 20080508 | CTD | ||||||||
| |||||||||||
| 08V2_LT6B_CTD | Lithuania | 20080508 | CTD | ||||||||
| |||||||||||
| 08V2_LT6_CTD | Lithuania | 20080508 | CTD | ||||||||
| |||||||||||
| 08V2_LT7_CTD | Lithuania | 20080508 | CTD | ||||||||
| |||||||||||
| 08V2_LTB-1_CTD | Lithuania | 20080507 | CTD | ||||||||
| |||||||||||
| 08V2_LTB-4_CTD | Lithuania | 20080507 | CTD | ||||||||
| |||||||||||
| 08V2_LTN-6_CTD | Lithuania | 20080508 | CTD | ||||||||
| |||||||||||
| 08V3_LT1B_CTD | Lithuania | 20080819 | CTD | ||||||||
| |||||||||||
| 08V3_LT1_CTD | Lithuania | 20080819 | CTD | ||||||||
| |||||||||||
| 08V3_LT2C_CTD | Lithuania | 20080820 | CTD | ||||||||
| |||||||||||
| 08V3_LT2_CTD | Lithuania | 20080819 | CTD | ||||||||
| |||||||||||
| 08V3_LT3_CTD | Lithuania | 20080819 | CTD | ||||||||
| |||||||||||
| 08V3_LT4C_CTD | Lithuania | 20080820 | CTD | ||||||||
| |||||||||||
| 08V3_LT4_CTD | Lithuania | 20080820 | CTD | ||||||||
| |||||||||||
| 08V3_LT5_CTD | Lithuania | 20080820 | CTD | ||||||||
| |||||||||||
| 08V3_LT64A_CTD | Lithuania | 20080820 | CTD | ||||||||
| |||||||||||
| 08V3_LT64_CTD | Lithuania | 20080820 | CTD | ||||||||
| |||||||||||
| 08V3_LT65_CTD | Lithuania | 20080820 | CTD | ||||||||
| |||||||||||
| 08V3_LT6B_CTD | Lithuania | 20080820 | CTD | ||||||||
| |||||||||||
| 08V3_LT6_CTD | Lithuania | 20080821 | CTD | ||||||||
| |||||||||||
| 08V3_LT7_CTD | Lithuania | 20080820 | CTD | ||||||||
| |||||||||||
| 08V3_LTB-1_CTD | Lithuania | 20080819 | CTD | ||||||||
| |||||||||||
| 08V3_LTB-4_CTD | Lithuania | 20080819 | CTD | ||||||||
| |||||||||||
| 08V4_LT1B_CTD | Lithuania | 20081022 | CTD | ||||||||
| |||||||||||
| 08V4_LT1_CTD | Lithuania | 20081022 | CTD | ||||||||
| |||||||||||
| 08V4_LT2C_CTD | Lithuania | 20081022 | CTD | ||||||||
| |||||||||||
| 08V4_LT2_CTD | Lithuania | 20081022 | CTD | ||||||||
| |||||||||||
| 08V4_LT3_CTD | Lithuania | 20081022 | CTD | ||||||||
| |||||||||||
| 08V4_LT4C_CTD | Lithuania | 20081023 | CTD | ||||||||
| |||||||||||
| 08V4_LT4_CTD | Lithuania | 20081023 | CTD | ||||||||
| |||||||||||
| 08V4_LT5_CTD | Lithuania | 20081023 | CTD | ||||||||
| |||||||||||
| 08V4_LT64A_CTD | Lithuania | 20081023 | CTD | ||||||||
| |||||||||||
| 08V4_LT64_CTD | Lithuania | 20081023 | CTD | ||||||||
| |||||||||||
| 08V4_LT65_CTD | Lithuania | 20081023 | CTD | ||||||||
| |||||||||||
| 08V4_LT6B_CTD | Lithuania | 20081023 | CTD | ||||||||
| |||||||||||
| 08V4_LT6_CTD | Lithuania | 20081023 | CTD | ||||||||
| |||||||||||
| 08V4_LT7_CTD | Lithuania | 20081023 | CTD | ||||||||
| |||||||||||
| 08V4_LTB-1_CTD | Lithuania | 20081022 | CTD | ||||||||
| |||||||||||
| 08V4_LTB-4_CTD | Lithuania | 20081022 | CTD | ||||||||
| |||||||||||
| 08V4_LTN-6_CTD | Lithuania | 20081023 | CTD | ||||||||
| |||||||||||
| 09V1_LT1B_CTD | Lithuania | 20090204 | CTD | ||||||||
| |||||||||||
| 09V1_LT1_CTD | Lithuania | 20090204 | CTD | ||||||||
| |||||||||||
| 09V1_LT2C_CTD | Lithuania | 20090204 | CTD | ||||||||
| |||||||||||
| 09V1_LT2_CTD | Lithuania | 20090204 | CTD | ||||||||
| |||||||||||
| 09V1_LT3_CTD | Lithuania | 20090204 | CTD | ||||||||
| |||||||||||
| 09V1_LT46_CTD | Lithuania | 20090205 | CTD | ||||||||
| |||||||||||
| 09V1_LT4C_CTD | Lithuania | 20090205 | CTD | ||||||||
| |||||||||||
| 09V1_LT4_CTD | Lithuania | 20090205 | CTD | ||||||||
| |||||||||||
| 09V1_LT5_CTD | Lithuania | 20090205 | CTD | ||||||||
| |||||||||||
| 09V1_LT64A_CTD | Lithuania | 20090205 | CTD | ||||||||
| |||||||||||
| 09V1_LT64_CTD | Lithuania | 20090205 | CTD | ||||||||
| |||||||||||
| 09V1_LT65_CTD | Lithuania | 20090205 | CTD | ||||||||
| |||||||||||
| 09V1_LT66_CTD | Lithuania | 20090205 | CTD | ||||||||
| |||||||||||
| 09V1_LT6B_CTD | Lithuania | 20090206 | CTD | ||||||||
| |||||||||||
| 09V1_LT6_CTD | Lithuania | 20090206 | CTD | ||||||||
| |||||||||||
| 09V1_LT7_CTD | Lithuania | 20090206 | CTD | ||||||||
| |||||||||||
| 09V1_LTB-1_CTD | Lithuania | 20090204 | CTD | ||||||||
| |||||||||||
| 09V1_LTB-4_CTD | Lithuania | 20090204 | CTD | ||||||||
| |||||||||||
| 09V1_LTN-6_CTD | Lithuania | 20090206 | CTD | ||||||||
| |||||||||||
| 09V2_LT1B_CTD | Lithuania | 20090506 | CTD | ||||||||
| |||||||||||
| 09V2_LT1_CTD | Lithuania | 20090507 | CTD | ||||||||
| |||||||||||
| 09V2_LT2C_CTD | Lithuania | 20090506 | CTD | ||||||||
| |||||||||||
| 09V2_LT2_CTD | Lithuania | 20090507 | CTD | ||||||||
| |||||||||||
| 09V2_LT3_CTD | Lithuania | 20090507 | CTD | ||||||||
| |||||||||||
| 09V2_LT4C_CTD | Lithuania | 20090506 | CTD | ||||||||
| |||||||||||
| 09V2_LT4_CTD | Lithuania | 20090506 | CTD | ||||||||
| |||||||||||
| 09V2_LT5_CTD | Lithuania | 20090506 | CTD | ||||||||
| |||||||||||
| 09V2_LT64A_CTD | Lithuania | 20090506 | CTD | ||||||||
| |||||||||||
| 09V2_LT64_CTD | Lithuania | 20090506 | CTD | ||||||||
| |||||||||||
| 09V2_LT65_CTD | Lithuania | 20090506 | CTD | ||||||||
| |||||||||||
| 09V2_LT6B_CTD | Lithuania | 20090508 | CTD | ||||||||
| |||||||||||
| 09V2_LT6_CTD | Lithuania | 20090508 | CTD | ||||||||
| |||||||||||
| 09V2_LT7_CTD | Lithuania | 20090508 | CTD | ||||||||
| |||||||||||